A4278512
Fmoc-β-(2-pyridyl)-D-Ala-OH , 98% , 185379-39-9
Synonym(s):
Fmoc-3-(2-pyridyl)-D -alanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB205.60 | In Stock |
|
| 5G | RMB827.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154.5 °C |
| Boiling point: | 514.13°C (rough estimate) |
| Density | 1.2692 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 2.98±0.10(Predicted) |
| color | White to off-white |
| BRN | 8721547 |
| Major Application | peptide synthesis |
| InChI | 1S/C23H20N2O4/c26-22(27)21(13-15-7-5-6-12-24-15)25-23(28)29-14-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-12,20-21H,13-14H2,(H,25,28)(H,26,27)/t21-/m1/s1 |
| InChIKey | DXIVJCDZOMUITR-OAQYLSRUSA-N |
| SMILES | OC(=O)[C@@H](Cc1ccccn1)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 185379-39-9(CAS DataBase Reference) |
Description and Uses
peptide synthesis
