A4280312
4-Fluorophenyl isothiocyanate , 98% , 1544-68-9
CAS NO.:1544-68-9
Empirical Formula: C7H4FNS
Molecular Weight: 153.18
MDL number: MFCD00004809
EINECS: 216-280-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5G | RMB128.00 | In Stock |
|
| 25G | RMB288.00 | In Stock |
|
| 100G | RMB1142.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24-26 °C (lit.) |
| Boiling point: | 228 °C (lit.) |
| Density | 1.25 |
| refractive index | 1.6195-1.6215 |
| Flash point: | 193 °F |
| storage temp. | 2-8°C |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Sensitive | Moisture Sensitive |
| BRN | 636596 |
| InChI | InChI=1S/C7H4FNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| InChIKey | NFIUJHJMCQQYDL-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(N=C=S)C=C1 |
| CAS DataBase Reference | 1544-68-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-fluoro-4-isothiocyanato-(1544-68-9) |
| EPA Substance Registry System | p-Fluorophenyl isothiocyanate (1544-68-9) |
Description and Uses
4-Fluorophenyl isothiocyanate has been used in the synthesis of thiourea derivatives. It has also been used in the preparation of -(4-phenylsulfonyl)-benzoic acid hydrazide.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H317-H334 |
| Precautionary statements | P260-P272-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,T,Xi |
| Risk Statements | 34-42 |
| Safety Statements | 23-26-36/37-39-45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| RTECS | NX8760000 |
| F | 10-21-19 |
| Hazard Note | Toxic/Irritant |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Resp. Sens. 1 Skin Corr. 1B Skin Sens. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








