A4281312
Fluorescent Brightener 367 , 98% , 5089-22-5
CAS NO.:5089-22-5
Empirical Formula: C24H14N2O2
Molecular Weight: 362.38
MDL number: MFCD00357168
EINECS: 225-803-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25G | RMB92.00 | In Stock |
|
| 100G | RMB199.20 | In Stock |
|
| 250G | RMB479.20 | In Stock |
|
| 500G | RMB803.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-212°C |
| Boiling point: | 521.9±33.0 °C(Predicted) |
| Density | 1.320±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.24±0.10(Predicted) |
| color | Light yellow to Amber to Dark green |
| Water Solubility | insoluble |
| InChI | InChI=1S/C24H14N2O2/c1-2-8-16-15(7-1)17(23-25-19-9-3-5-11-21(19)27-23)13-14-18(16)24-26-20-10-4-6-12-22(20)28-24/h1-14H |
| InChIKey | WFYSPVCBIJCZPX-UHFFFAOYSA-N |
| SMILES | C1(C2=NC3=CC=CC=C3O2)=C2C(C=CC=C2)=C(C2=NC3=CC=CC=C3O2)C=C1 |
| LogP | 7.57 at 25℃ |
| CAS DataBase Reference | 5089-22-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoxazole, 2,2'-(1,4-naphthalenediyl)bis- (5089-22-5) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS02 |
| Signal word | Danger |
| Hazard statements | H314-H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405 |
| HS Code | 3204200090 |





![2,2-(1,2-ethenediyl)bis[5-[[4-(4-morpholinyl)-6-(phenylamino)-1,3,5-triazin-2-yl]amino]-benzenesulfonicacid],disodiumsalt](https://img.chemicalbook.com/CAS/GIF/16090-02-1.gif)


