A4282312
6-Fluoro-3-pyridinylboronic acid , 96% , 351019-18-6
Synonym(s):
2-Fluoro-5-pyridylboronic acid
CAS NO.:351019-18-6
Empirical Formula: C5H5BFNO2
Molecular Weight: 140.91
MDL number: MFCD03411559
EINECS: 627-412-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB36.00 | In Stock |
|
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB115.20 | In Stock |
|
| 25G | RMB396.80 | In Stock |
|
| 100g | RMB1308.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-178°C (dec.) |
| Boiling point: | 311.5±52.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 6.97±0.10(Predicted) |
| color | White to Almost white |
| BRN | 8974962 |
| InChI | InChI=1S/C5H5BFNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3,9-10H |
| InChIKey | OJBYZWHAPXIJID-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(F)N=C1)(O)O |
| CAS DataBase Reference | 351019-18-6(CAS DataBase Reference) |
Description and Uses
Used in a synthesis of halohydroxypyridines by hydroxydeboronation with basic hydrogen peroxide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






