A4283612
Fmoc-Gly-OH , 98% , 29022-11-5
Synonym(s):
FMOC-Glycine;Fmoc-Gly-OH;N-α-Fmoc-glycine
CAS NO.:29022-11-5
Empirical Formula: C17H15NO4
Molecular Weight: 297.31
MDL number: MFCD00037140
EINECS: 249-373-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB79.20 | In Stock |
|
| 100G | RMB263.20 | In Stock |
|
| 500g | RMB1231.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-175 °C(lit.) |
| Boiling point: | 438.82°C (rough estimate) |
| Density | 1.1671 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | 2-8°C |
| solubility | almost transparency in Methanol |
| pka | 3.89±0.10(Predicted) |
| form | Powder |
| color | White |
| BRN | 2163967 |
| InChI | InChI=1S/C17H15NO4/c19-16(20)9-18-17(21)22-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15H,9-10H2,(H,18,21)(H,19,20) |
| InChIKey | NDKDFTQNXLHCGO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CNC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 29022-11-5(CAS DataBase Reference) |
Description and Uses
Fmoc-Gly-OH is an N-Fmoc-protected form of Glycine (G615990). Glycine is a nonessential amino acid that acts as an inhibitory neyrotransmitter in the vertebrate central nervous system. Glycine also posesses cytoprotective against oxidant damage in the kidney.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29242995 |







