A4284812
3-Formylphenylboronic acid , 97% , 87199-16-4
Synonym(s):
(3-Formylbenzene)boronic acid;m-formyl-benzeneboronic acid;m-Formylphenylboronic acid;3-(Dihydroxyboryl)benzaldehyde;3-Boronobenzaldehyde
CAS NO.:87199-16-4
Empirical Formula: C7H7BO3
Molecular Weight: 149.94
MDL number: MFCD00161356
EINECS: 628-589-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100G | RMB531.20 | In Stock |
|
| 500g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109-113 °C |
| Boiling point: | 354.4±44.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | Powder, Crystals, and/or Chunks |
| pka | 7.83±0.10(Predicted) |
| color | Off-white to beige or light orange |
| Sensitive | Air Sensitive |
| BRN | 3030769 |
| InChI | InChI=1S/C7H7BO3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-5,10-11H |
| InChIKey | HJBGZJMKTOMQRR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(C=O)=C1)(O)O |
| CAS DataBase Reference | 87199-16-4(CAS DataBase Reference) |
Description and Uses
Reagent used:
- To study the effects of boronic acid on fluoride-selective chemosignaling behavior of merocyanine dye
- As exciton-coupled CD probes for epigallocatechin gallate
Biological inhibitor of γ-glutamyltranspeptidase
Reactant involved in:
- Palladium-catalyzed homocoupling
- Suzuki coupling reactions
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 22-26-36/37/39-45-37/39-27 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, MOISTURE SENSITIVE |
| PackingGroup | Ⅲ |
| HS Code | 29319090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







