A4284912
2-Fluorophenylboronic acid , 98% , 1993-03-9
Synonym(s):
o-fluoro-benzeneboronic acid;2-Fluorobenzeneboronic acid
CAS NO.:1993-03-9
Empirical Formula: C6H6BFO2
Molecular Weight: 139.92
MDL number: MFCD00674013
EINECS: 671-858-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB128.00 | In Stock |
|
| 100g | RMB439.20 | In Stock |
|
| 500g | RMB1785.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-110 °C (lit.) |
| Boiling point: | 267.8±42.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 8.32±0.58(Predicted) |
| color | White to light yellow |
| BRN | 3030413 |
| InChI | InChI=1S/C6H6BFO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4,9-10H |
| InChIKey | QCSLIRFWJPOENV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1F)(O)O |
| CAS DataBase Reference | 1993-03-9(CAS DataBase Reference) |
Description and Uses
Used for the preparation of biologically active biphenyls and arylboron difluoride Lewis acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36/37/39-27-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |



