A4285012
3-Fluorophenylboronic acid , 97% , 768-35-4
Synonym(s):
(3-Fluorophenyl-1-yl)boronic acid;m-fluoro-Benzeneboronic acid;m-Fluorophenylboronic acid;3-Fluorobenzeneboronic acid
CAS NO.:768-35-4
Empirical Formula: C6H6BFO2
Molecular Weight: 139.92
MDL number: MFCD00236042
EINECS: 476-720-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB46.40 | In Stock |
|
| 25G | RMB119.20 | In Stock |
|
| 100g | RMB423.20 | In Stock |
|
| 500g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214-218 °C (lit.) |
| Boiling point: | 271.4±42.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 7.50±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | 27.1g/L at 20℃ |
| BRN | 3030632 |
| InChI | InChI=1S/C6H6BFO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H |
| InChIKey | KNXQDJCZSVHEIW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(F)=C1)(O)O |
| LogP | 2 at 23℃ |
| CAS DataBase Reference | 768-35-4(CAS DataBase Reference) |
Description and Uses
Recently used to make novel liquid crystalline fluorobiphenylcyclohexenes and difluoroterphenyls by palladium-catalyzed cross-couplings also used in the synthesis of o-phenylphenols as potent leukotriene B4 receptor agonists.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29163990 |




