A4286412
2-Fluoro-4-biphenylylboronic acid , 97% , 178305-99-2
CAS NO.:178305-99-2
Empirical Formula: C12H10BFO2
Molecular Weight: 216.02
MDL number: MFCD01075707
EINECS: 681-586-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB163.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 243-248 °C (lit.) |
| Boiling point: | 377.3±52.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 7.52±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C12H10BFO2/c14-12-8-10(13(15)16)6-7-11(12)9-4-2-1-3-5-9/h1-8,15-16H |
| InChIKey | BWYWXDFYJSIUBE-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(c(F)c1)-c2ccccc2 |
| CAS DataBase Reference | 178305-99-2(CAS DataBase Reference) |
Description and Uses
2-Fluorobiphenyl-4-ylboronic acid
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 22-24/25-45-36/37/39-27-26-37 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 13 - Non Combustible Solids |




