A4288920
3-Hydroxy-2,4,6-triiodobenzoic acid , 97% , 53279-72-4
CAS NO.：53279-72-4
Empirical Formula: C7H3I3O3
Molecular Weight: 515.81
MDL number: MFCD00020305
EINECS: 258-457-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB63.20 | In Stock |
|
| 5g | RMB186.40 | In Stock |
|
| 25g | RMB745.60 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-215°C |
| Boiling point: | 389.2±42.0 °C(Predicted) |
| Density | 3.095±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 1.22±0.10(Predicted) |
| form | Solid |
| color | Light yellow to brown |
| Sensitive | Light Sensitive |
| BRN | 2113494 |
| InChI | InChI=1S/C7H3I3O3/c8-2-1-3(9)6(11)5(10)4(2)7(12)13/h1,11H,(H,12,13) |
| InChIKey | GIAVHGFPMPSIFI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(I)C=C(I)C(O)=C1I |
| CAS DataBase Reference | 53279-72-4(CAS DataBase Reference) |
Description and Uses
HTBA(3-Hydroxy-2,4,6-triiodobenzoic acid) for your research needs.Off-white to yellow powder.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38-41-37/38-22 |
| Safety Statements | 22-26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 29181990 |
