A4294812
D-Fructose , Ph.Eur.,BP,USP , 57-48-7
Synonym(s):
D(-)-Fructose;Fruit sugar;Laevulose, Levulose;Laevulosum (Fructosum);D- (?)-Fructose
CAS NO.:57-48-7
Empirical Formula: C6H12O6
Molecular Weight: 180.16
MDL number: MFCD00148910
EINECS: 200-333-3
| Pack Size | Price | Stock | Quantity |
| 100G | RMB63.20 | In Stock |
|
| 500G | RMB126.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-122 °C (dec.)(lit.) |
| Boiling point: | 232.96°C (rough estimate) |
| alpha | -92.25 º (c=10,H2O,on dry sub.) |
| Density | 1.59 |
| bulk density | 700-800kg/m3 |
| refractive index | -92 ° (C=4, H2O) |
| storage temp. | room temp |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| pka | pKa (18°): 12.06 |
| form | Crystals or Crystalline Powder |
| color | White |
| PH | 5.0-7.0 (25℃, 0.1M in H2O) |
| Odor | at 100.00 %. odorless |
| Odor Type | odorless |
| biological source | natural (organic) |
| optical activity | [α]20/D 93.5 to 91.0°, c = 10% in H2O |
| Water Solubility | 3750 g/L (20 ºC) |
| λmax | λ: 260 nm Amax: 0.04 λ: 280 nm Amax: 0.04 |
| Merck | 14,4273 |
| BRN | 1239004 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | HUMECTANT |
| Cosmetic Ingredient Review (CIR) | D(-)-Fructose (57-48-7) |
| InChI | 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6-/m1/s1 |
| InChIKey | LKDRXBCSQODPBY-GWVKGMJFSA-N |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO |
| LogP | -1.029 (est) |
| CAS DataBase Reference | 57-48-7(CAS DataBase Reference) |
| NIST Chemistry Reference | «beta»-D-Fructose(57-48-7) |
| EPA Substance Registry System | D-Fructose (57-48-7) |
Description and Uses
fructose is a naturally occurring sugar in fruits and honey. It has moisture-binding and skin-softening properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 24/25-45-36/37/39-27-26 |
| WGK Germany | 3 |
| RTECS | LS7120000 |
| F | 3 |
| Autoignition Temperature | 360 °C |
| TSCA | TSCA listed |
| HS Code | 17025000 |
| Storage Class | 11 - Combustible Solids |



