A4299220
2,3,4,5,6-Pentafluorobenzonitrile , 98% , 773-82-0
CAS NO.:773-82-0
Empirical Formula: C7F5N
Molecular Weight: 193.07
MDL number: MFCD00001775
EINECS: 212-259-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB27.20 | In Stock |
|
| 25g | RMB80.00 | In Stock |
|
| 100g | RMB286.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 2.4 °C |
| Boiling point: | 162-164 °C(lit.) |
| Density | 1.532 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 85 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 1913453 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C7F5N/c8-3-2(1-13)4(9)6(11)7(12)5(3)10 |
| InChIKey | YXWJGZQOGXGSSC-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(F)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 773-82-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, pentafluoro-(773-82-0) |
| EPA Substance Registry System | Pentafluorobenzonitrile (773-82-0) |
Description and Uses
Pentafluorobenzonitrile is useful as a catalyst in organic reactions, and as well is useful in liquid-?phase exfoliation of graphite for solubilized graphene.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS02 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H331-H335-H226 |
| Precautionary statements | P210-P261-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,F,T |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Flammable |
| TSCA | T |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29269095 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







