A4301012
trans-Ferulic Acid , 99% , 537-98-4
Synonym(s):
trans-4-Hydroxy-3-methoxycinnamic acid;trans-Ferulic acid;Ferulic acid
CAS NO.:537-98-4
Empirical Formula: C10H10O4
Molecular Weight: 194.18
MDL number: MFCD00004400
EINECS: 208-679-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB99.20 | In Stock |
|
| 250g | RMB255.20 | In Stock |
|
| 500G | RMB468.00 | In Stock |
|
| 2.5kg | RMB2199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-172 °C(lit.) |
| Boiling point: | 250.62°C (rough estimate) |
| Density | 1.316(20.0000℃) |
| refractive index | 1.5030 (estimate) |
| Flash point: | 150℃ |
| storage temp. | Store below +30°C. |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder |
| pka | 4.58±0.10(Predicted) |
| color | slightly yellow |
| biological source | synthetic |
| Water Solubility | Soluble in alcohol and hot water. |
| Merck | 14,4062 |
| BRN | 1371483 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | 1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ |
| InChIKey | KSEBMYQBYZTDHS-HWKANZROSA-N |
| SMILES | O(C)c1c(ccc(c1)\C=C\C(=O)O)O |
| LogP | 1.641 (est) |
| CAS DataBase Reference | 537-98-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, (e)-(537-98-4) |
Description and Uses
These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | UD3365500 |
| TSCA | TSCA listed |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |





