PRODUCT Properties
| Melting point: | 73-77 °C (lit.) |
| Boiling point: | 444.2±30.0 °C(Predicted) |
| alpha | -20.5 º (c=1, MeOH) |
| Density | 1.245±0.06 g/cm3(Predicted) |
| refractive index | -21 ° (C=1, MeOH) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 12.85±0.10(Predicted) |
| form | Viscous Liquid |
| color | Brown |
| optical activity | [α]20/D 20.5°, c = 1 in methanol |
| Water Solubility | Soluble in water 11.4 g/L (25°C). |
| Major Application | peptide synthesis |
| InChI | 1S/C11H14N2O/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11/h1-4,6,9,13-14H,5,7,12H2/t9-/m0/s1 |
| InChIKey | UDQCRUSSQAXPJY-VIFPVBQESA-N |
| SMILES | N[C@H](CO)Cc1c[nH]c2ccccc12 |
| CAS DataBase Reference | 2899-29-8(CAS DataBase Reference) |
Description and Uses
L-Tryptophanol is an amino acid used in the construction of peptides and proteins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H302 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36-36/37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





