A4305612
Fmoc-Asn-OH , 98% , 71989-16-7
Synonym(s):
Fmoc-Asn-OH;N-α-Fmoc-L-asparagine
CAS NO.:71989-16-7
Empirical Formula: C19H18N2O5
Molecular Weight: 354.36
MDL number: MFCD00037132
EINECS: 276-252-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB20.00 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB82.40 | In Stock |
|
| 100G | RMB296.80 | In Stock |
|
| 500g | RMB1335.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190 °C (dec.)(lit.) |
| alpha | -13 º (c=1,DMF) |
| Boiling point: | 487.59°C (rough estimate) |
| Density | 1.3354 (rough estimate) |
| refractive index | -13 ° (C=1, DMF) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| form | powder to crystal |
| pka | 3.68±0.10(Predicted) |
| color | White to Almost white |
| optical activity | -11..88°(C=0.01g/mI, DMF, 20°C, 589nm) |
| BRN | 4335103 |
| Major Application | peptide synthesis |
| InChI | 1S/C19H18N2O5/c20-17(22)9-16(18(23)24)21-19(25)26-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H2,20,22)(H,21,25)(H,23,24) |
| InChIKey | YUGBZNJSGOBFOV-UHFFFAOYSA-N |
| SMILES | N(C(CC(=O)N)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| CAS DataBase Reference | 71989-16-7(CAS DataBase Reference) |
Description and Uses
Nα-Fmoc-L-asparagine is an N-Fmoc-protected form of L-Asparagine (A790005). L-Asparagine was first isolated by Robiquet and Vauquelin from asparagus juice (a high source of L-asparagine). L-Asparagine is often incorporated into proteins, and is a basis for some cancer therapies as certain cancerous cells require L-asparagine for growth.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| F | 21 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |





