A4306012
m-Fluoro-DL-tyrosine , 99% , 403-90-7
CAS NO.：403-90-7
Empirical Formula: C9H10FNO3
Molecular Weight: 199.18
MDL number: MFCD00063075
EINECS: 206-964-0
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB216.80 | In Stock |
|
| 500mg | RMB911.20 | In Stock |
|
| 1g | RMB1087.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 280 °C (dec.) (lit.) |
| Boiling point: | 362.4±42.0 °C(Predicted) |
| Density | 1.2523 (estimate) |
| storage temp. | 2-8°C |
| form | powder |
| pka | 2.21±0.20(Predicted) |
| color | white |
| Water Solubility | Soluble in water (28 g/L). |
| BRN | 3204804 |
| Stability: | Stable. Incompatible with strong reducing agents, strong oxidizing agents. |
| InChI | 1S/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
| InChIKey | VIIAUOZUUGXERI-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccc(O)c(F)c1)C(O)=O |
| CAS DataBase Reference | 403-90-7(CAS DataBase Reference) |
Description and Uses
3-Fluoro-DL-tyrosine is used for tyrosine in the biosynthesis of proteins such as β-galactosidases (Escherichia coli), bacteriorhodopsin and intestinal microvillar enzymes, aminopeptidase N, to study the effect of halogenated tryosines on the proteins properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | YP2660000 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 2922500090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
