PRODUCT Properties
| Melting point: | 53-55 °C(lit.) |
| Boiling point: | 88 °C (0.4 mmHg) |
| Density | 1.5 g/cm3 |
| refractive index | 1.5300 (estimate) |
| Flash point: | 78 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear |
| pka | 6.06±0.15(Predicted) |
| color | Colorless needles from pet ether |
| Water Solubility | 591mg/L(25 ºC) |
| BRN | 1867596 |
| Stability: | Stability Combustible. Incompatible with strong oxidizing agents, acid anhydrides, acid chlorides. May be hygroscopic. |
| InChI | InChI=1S/C6H3Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H |
| InChIKey | XGCHAIDDPMFRLJ-UHFFFAOYSA-N |
| SMILES | C1(O)=C(Cl)C=CC(Cl)=C1Cl |
| CAS DataBase Reference | 933-75-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2,3,6-Trichlorophenol (933-75-5) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/38 |
| Safety Statements | 26-28 |
| RIDADR | UN 2020 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | SN1300000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2908190090 |
| Hazardous Substances Data | 933-75-5(Hazardous Substances Data) |
| Toxicity | mmo-sat 10 mg/plate TECSDY 14,143,87 |






