A4306712
2-Fluoro-5-methylaniline , 98% , 452-84-6
Synonym(s):
6-Fluoro-m-toluidine
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100G | RMB375.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 80-86 °C/11 mmHg (lit.) |
| Density | 1.109 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 179 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 3.33±0.10(Predicted) |
| form | Liquid |
| color | Clear yellow to brown |
| BRN | 2715995 |
| InChI | InChI=1S/C7H8FN/c1-5-2-3-6(8)7(9)4-5/h2-4H,9H2,1H3 |
| InChIKey | QZUXMXZNVAJNSE-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(C)=CC=C1F |
| CAS DataBase Reference | 452-84-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 6-Fluoro-m-toluidine(452-84-6) |
Description and Uses
2-Fluoro-5-methylaniline can be used in organic synthesis and the synthesis of small molecule drugs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-23/24/25 |
| Safety Statements | 26-36-45-2636/37/39-36/37/39-27 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






