A4309212
Fenclorim , Analysis standard product, 99.3% , 3740-92-9
Synonym(s):
4,6-Dichloro-2-phenylpyrimidine
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-93°C |
| Boiling point: | 235.5±33.0 °C(Predicted) |
| Density | 1.363±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Sparingly) |
| pka | -4.69±0.30(Predicted) |
| color | Off-White to Pale Yellow |
| Water Solubility | Insoluble in water |
| BRN | 142293 |
| InChI | InChI=1S/C10H6Cl2N2/c11-8-6-9(12)14-10(13-8)7-4-2-1-3-5-7/h1-6H |
| InChIKey | NRFQZTCQAYEXEE-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=NC(Cl)=CC(Cl)=N1 |
| CAS DataBase Reference | 3740-92-9(CAS DataBase Reference) |
Description and Uses
Fenclorim (4,6-dichloro-2-phenylpyrimidine) is a pyrimidine herbicide safener that effectively protects rice (Oryza sativa L.) from the phytotoxicity of certain herbicides. It improves rice tolerance to chloroacetanilide herbicides by enhancing the expression of detoxifying glutathione S-transferase (GST). Compared with seed treatment with safener alone, sequential seed treatment with safener and insecticide minimizes the release of fenclorim without causing residue problems in the ecosystem and harvested rice.
Herbicide safener.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H317-H318-H332 |
| Precautionary statements | P261-P271-P280-P302+P352-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20-43 |
| Safety Statements | 36/37 |
| RIDADR | 3077 |
| WGK Germany | 2 |
| RTECS | UV8258400 |
| HS Code | 2933.59.1000 |
| HazardClass | 9 |
| PackingGroup | III |







