A4310412
3-Fluoro-4-iodobromobenzene , 99% , 105931-73-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB69.60 | In Stock |
|
| 100G | RMB232.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-51 °C (lit.) |
| Boiling point: | 243.9±20.0 °C(Predicted) |
| Density | 2.2691 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder, Crystals, and/or Chunks |
| color | Off-white to beige |
| Sensitive | Light Sensitive |
| BRN | 4740250 |
| InChI | InChI=1S/C6H3BrFI/c7-4-1-2-6(9)5(8)3-4/h1-3H |
| InChIKey | XRMZKCQCINEBEI-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 105931-73-5(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-iodobromobenzene may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







