A4310812
4-Fluorophenylacetic acid , 98% , 405-50-5
CAS NO.:405-50-5
Empirical Formula: C8H7FO2
Molecular Weight: 154.14
MDL number: MFCD00004343
EINECS: 206-972-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB50.40 | In Stock |
|
| 100G | RMB150.40 | In Stock |
|
| 250g | RMB383.20 | In Stock |
|
| 500G | RMB684.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-83 °C (lit.) |
| Boiling point: | 164°C (2.25 torr) |
| Density | 1.1850 (estimate) |
| Flash point: | >100°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Shiny Crystalline Powder or Flakes |
| pka | pK1:4.25 (25°C) |
| color | White |
| Water Solubility | Insoluble in water. |
| Merck | 14,4177 |
| BRN | 972145 |
| InChI | InChI=1S/C8H7FO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | MGKPFALCNDRSQD-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(F)C=C1 |
| CAS DataBase Reference | 405-50-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetic acid, 4-fluoro-(405-50-5) |
| EPA Substance Registry System | Benzeneacetic acid, 4-fluoro- (405-50-5) |
Description and Uses
4-Fluorophenylacetic acid is used as an intermediate in the production of fluorinated anesthetics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280g-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 38-36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |





