A4316912
Fmoc-Glu(OtBu)-OPfp , 98% , 86061-04-3
Synonym(s):
Fmoc-L -glutamic acid 5-tert-butyl 1-(pentafluorophenyl) ester;Fmoc-Glu(OtBu)-OPfp;N-α-Fmoc-L-glutamic acid γ-t.-butyl ester pentafluorophenyl ester
CAS NO.:86061-04-3
Empirical Formula: C30H26F5NO6
Molecular Weight: 591.52
MDL number: MFCD00065647
EINECS: 685-333-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB42.40 | In Stock |
|
| 5G | RMB182.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-120℃ |
| Boiling point: | 674.2±55.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 10.08±0.46(Predicted) |
| form | Solid |
| color | White to Almost white |
| BRN | 3642680 |
| Major Application | peptide synthesis |
| InChIKey | AIDYQYOPUBOMTR-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(=O)Oc4c(F)c(F)c(F)c(F)c4F |
| CAS DataBase Reference | 86061-04-3(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 |







