A4321612
Fmoc-Phg-OH , ≥98.5% , 102410-65-1
Synonym(s):
Fmoc-L -α-phenylglycine;Fmoc-Phg-OH;N-α-Fmoc-L-phenylglycine
CAS NO.：102410-65-1
Empirical Formula: C23H19NO4
Molecular Weight: 373.4
MDL number: MFCD00155632
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.00 | In Stock |
|
| 25G | RMB153.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-180 °C |
| Boiling point: | 606.3±50.0 °C(Predicted) |
| alpha | 81 º (c=1% in DMF) |
| Density | 1.299±0.06 g/cm3(Predicted) |
| refractive index | 81 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| pka | 3.39±0.10(Predicted) |
| form | Solid |
| color | White to Almost white |
| optical activity | [α]20/D +81±3°, c = 1% in DMF |
| BRN | 5309005 |
| Major Application | peptide synthesis |
| InChI | 1S/C23H19NO4/c25-22(26)21(15-8-2-1-3-9-15)24-23(27)28-14-20-18-12-6-4-10-16(18)17-11-5-7-13-19(17)20/h1-13,20-21H,14H2,(H,24,27)(H,25,26)/t21-/m0/s1 |
| InChIKey | PCJHOCNJLMFYCV-NRFANRHFSA-N |
| SMILES | OC(=O)[C@@H](NC(=O)OCC1c2ccccc2-c3ccccc13)c4ccccc4 |
| CAS DataBase Reference | 102410-65-1(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
