A4322612
Fmoc-N-methyl-L-valine , 98% , 84000-11-3
Synonym(s):
Fmoc-N-methyl-L -valine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.80 | In Stock |
|
| 5G | RMB141.60 | In Stock |
|
| 25G | RMB464.80 | In Stock |
|
| 100g | RMB1822.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187-190 °C |
| alpha | -68 º (c=1% in DMF) |
| Boiling point: | 527.6±29.0 °C(Predicted) |
| Density | 1.214±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.92±0.10(Predicted) |
| color | White |
| optical activity | [α]20/D 68.0±3°, c = 1% in DMF |
| Water Solubility | Slightly soluble in water and dimethyl formamide. |
| BRN | 4560212 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C21H23NO4/c1-13(2)19(20(23)24)22(3)21(25)26-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,13,18-19H,12H2,1-3H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | YCXXXPZNQXXRIG-IBGZPJMESA-N |
| SMILES | C(O)(=O)[C@H](C(C)C)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C |
| CAS DataBase Reference | 84000-11-3(CAS DataBase Reference) |
Description and Uses
N-Fmoc-N-methyl-L-valine (Fmoc-N-Me-Val-OH) is used as enzyme substrates and reagents, culture media additives, dyes, stains and indicators. It is also involved in the preparation of N-methylated peptides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |





