A4327312
2-Fluoroisonicotinic Acid , 98% , 402-65-3
Synonym(s):
2-Fluoroisonicotinic acid
CAS NO.：402-65-3
Empirical Formula: C6H4FNO2
Molecular Weight: 141.1
MDL number: MFCD02181194
EINECS: 200-589-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB191.20 | In Stock |
|
| 1G | RMB559.20 | In Stock |
|
| 5G | RMB1599.20 | In Stock |
|
| 25g | RMB3999.20 | In Stock |
|
| 100g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C (dec.)(lit.) |
| Boiling point: | 396.6±22.0 °C(Predicted) |
| Density | 1.419±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 3.03±0.10(Predicted) |
| form | Powder |
| color | White to Almost white |
| InChI | InChI=1S/C6H4FNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3H,(H,9,10) |
| InChIKey | JMPFWDWYGOWUFP-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 402-65-3(CAS DataBase Reference) |
Description and Uses
2-Fluoroisonicotinic acid is a catalyst in organic reactions and serves as a starting material for the synthesis of fluorinated compounds. Furthermore, it plays a role in the synthesis of dyes, pigments, and various other organic compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
