A4328412
2-Fluoro-5-(trifluoromethyl)aniline , 98% , 535-52-4
Synonym(s):
α,α,α,6-Tetrafluoro-m-toluidine;3-Amino-4-fluorobenzotrifluoride
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB53.60 | In Stock |
|
| 100G | RMB208.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 155 °C (lit.) |
| Density | 1.378 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 158 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform, Methanol |
| form | Oil |
| pka | 1.98±0.10(Predicted) |
| Specific Gravity | 1.378 |
| color | Clear Colourless |
| BRN | 1950800 |
| InChI | InChI=1S/C7H5F4N/c8-5-2-1-4(3-6(5)12)7(9,10)11/h1-3H,12H2 |
| InChIKey | DRKWGMXFFCPZLW-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(C(F)(F)F)=CC=C1F |
| CAS DataBase Reference | 535-52-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Alpha,alpha,alpha,6-tetrafluoro-m-toluidine(535-52-4) |
Description and Uses
2-Fluoro-5-(trifluoromethyl)aniline may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 20/21/22-36/37/38-23-21/22 |
| Safety Statements | 26-36/37-45-36/37/39 |
| RIDADR | UN2810/6.1/II |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29214200 |
