PRODUCT Properties
| Melting point: | 98-101 °C (lit.) |
| Boiling point: | 112-120C |
| Density | 1.219±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 16.73±0.30(Predicted) |
| form | Solid |
| color | Light yellow to Brown |
| InChI | InChI=1S/C9H8FN/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-5,11H,1H3 |
| InChIKey | JJIUISYYTFDATN-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(F)C=C2)C=C1C |
| CAS DataBase Reference | 399-72-4(CAS DataBase Reference) |
Description and Uses
5-Fluoro-2-methylindole is a chemical intermediate that can be used in the synthesis of other compounds. It is a versatile building block with many applications, such as being a useful intermediate for the synthesis of heterocyclic compounds. This compound reacts with aniline to form 2,6-diaminopyridine, which has been shown to have anti-inflammatory properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36-45-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
