A4332512
2-Fluoroanisole , 98% , 321-28-8
CAS NO.：321-28-8
Empirical Formula: C7H7FO
Molecular Weight: 126.13
MDL number: MFCD00000316
EINECS: 206-284-4
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB24.00 | In Stock |
|
| 10ml | RMB32.00 | In Stock |
|
| 25ML | RMB44.00 | In Stock |
|
| 100ML | RMB135.20 | In Stock |
|
| 500ML | RMB663.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −39 °C(lit.) |
| Boiling point: | 154-155 °C(lit.) |
| Density | 1.124 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 140 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Soluble), Methanol (Sparingly) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.124 |
| BRN | 1859755 |
| InChI | InChI=1S/C7H7FO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| InChIKey | JIXDOBAQOWOUPA-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC=C1OC |
| CAS DataBase Reference | 321-28-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-fluoro-2-methoxy-(321-28-8) |
Description and Uses
2-Fluoroanisole is a useful synthetic intermediate with antifungal activity.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P240-P241-P280a-P303+P361+P353-P501a |
| Hazard Codes | F,Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-36/37/39-27-26 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29093090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
