A4332812
3-Fluoro-5-methylbenzoic acid , 97% , 518070-19-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.80 | In Stock |
|
| 5G | RMB138.40 | In Stock |
|
| 25g | RMB519.20 | In Stock |
|
| 100g | RMB1229.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-143℃ |
| Boiling point: | 266.2±20.0 °C(Predicted) |
| Density | 1.258±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| pka | 3.93±0.10(Predicted) |
| color | White |
| Water Solubility | Soluble in water (25°C) |
| InChI | InChI=1S/C8H7FO2/c1-5-2-6(8(10)11)4-7(9)3-5/h2-4H,1H3,(H,10,11) |
| InChIKey | XPUFVYIUPYNLPD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C)=CC(F)=C1 |
| CAS DataBase Reference | 518070-19-4(CAS DataBase Reference) |
Description and Uses
3-Fluoro-5-methylbenzoic Acid is an intermediate used to prepare five-membered heterocyclic compound as mGluR5 receptor antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2916310090 |







