A4333012
5-Fluoro-2-methylbenzoic Acid , 99% , 33184-16-6
CAS NO.：33184-16-6
Empirical Formula: C8H7FO2
Molecular Weight: 154.14
MDL number: MFCD00042294
EINECS: 608-840-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB439.20 | In Stock |
|
| 500g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-132 °C (lit.) |
| Boiling point: | 262.1±20.0 °C(Predicted) |
| Density | 1.258±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 3.53±0.25(Predicted) |
| color | Beige to light gray |
| BRN | 2249813 |
| InChI | InChI=1S/C8H7FO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | JVBLXLBINTYFPR-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=CC=C1C |
| CAS DataBase Reference | 33184-16-6(CAS DataBase Reference) |
Description and Uses
5-Fluoro-2-methylbenzoic acid may be used in the preparation of:
- 5-fluoro-3-hydroxy-2-methylbenzoic acid
- 5-fluoro-2-methyl-3-nitrobenzoic acid methyl ester
- 5-fluoro-N,2-dimethylbenzamide
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
