A4334612
2-Fluoro-4-nitrotoluene , 98% , 1427-07-2
CAS NO.:1427-07-2
Empirical Formula: C7H6FNO2
Molecular Weight: 155.13
MDL number: MFCD00007199
EINECS: 215-845-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB367.20 | In Stock |
|
| 500g | RMB1774.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31-35 °C (lit.) |
| Boiling point: | 65-68 °C/2 mmHg (lit.) |
| Density | 1.3021 (estimate) |
| Flash point: | 165 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Low Melting Solid |
| color | Yellow to brown |
| Water Solubility | Insoluble in water. Solubility in methanol gives very faint turbidity. |
| FreezingPoint | 32.0 to 35.0 ℃ |
| BRN | 2250156 |
| InChI | InChI=1S/C7H6FNO2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,1H3 |
| InChIKey | WIQISTBTOQNVCE-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C([N+]([O-])=O)C=C1F |
| CAS DataBase Reference | 1427-07-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2-fluoro-1-methyl-4-nitro-(1427-07-2) |
Description and Uses
2-Fluoro-4-nitrotoluene was used in the synthesis of 2-fluoro-4-nitrobenzoic acid.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P210-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi,F |
| Risk Statements | 20/21/22-36/37/38-11 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




