A4334812
2-Fluoro-6-nitrotoluene , 98% , 769-10-8
CAS NO.:769-10-8
Empirical Formula: C7H6FNO2
Molecular Weight: 155.13
MDL number: MFCD00007197
EINECS: 212-203-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB116.80 | In Stock |
|
| 100G | RMB313.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 6.5-7 °C (lit.) |
| Boiling point: | 97 °C/11 mmHg (lit.) |
| Density | 1.27 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 192 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Amber to Dark green |
| Specific Gravity | 1.270 |
| BRN | 2361978 |
| InChI | InChI=1S/C7H6FNO2/c1-5-6(8)3-2-4-7(5)9(10)11/h2-4H,1H3 |
| InChIKey | GXPIVRKDWZKIKZ-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC([N+]([O-])=O)=C1C |
| CAS DataBase Reference | 769-10-8(CAS DataBase Reference) |
Description and Uses
1-Fluoro-2-methyl-3-nitrobenzene
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H227-H302-H312-H331 |
| Precautionary statements | P261-P280-P305+P351+P338-P210e-P405-P501a |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-28A-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




