PRODUCT Properties
| Melting point: | 28 °C |
| Boiling point: | 241 °C |
| Density | 1.262 |
| refractive index | 1.524 |
| Flash point: | 22 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.262 |
| color | Red-brown |
| InChI | InChI=1S/C7H6FNO2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChIKey | OORBDHOQLZRIQR-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(C)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 446-11-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluoro-3-nitrotoluene(446-11-7) |
Description and Uses
The molecular structure of 4-fluoro-3-nitrotoluene contains four functional groups: benzene ring, fluorine atom, nitro group and methyl group. Among them, the benzene ring is the basic structural unit of aromatic compounds, the fluorine atom has a strong electron-withdrawing property, the nitro group is a strong electron-withdrawing group, and the methyl group is an electron-donating group. 4-fluoro-3-nitrotoluene has a wide range of applications in organic synthesis, mainly as a pharmaceutical and pesticide intermediate. For example, it can be used to synthesize a variety of drugs, such as cardiovascular drugs, anti-inflammatory drugs, antibiotics, etc. In pesticides, 4-fluoro-3-nitrotoluene can prepare herbicides, fungicides, insecticides, etc. In addition, 4-fluoro-3-nitrotoluene can also be used as an intermediate in synthetic dyes, plastics, synthetic fibers, etc. In analytical chemistry, it can be used as a standard solution for titration analysis, calibration of instruments and devices, evaluation methods, working standards, quality assurance/quality control, etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332-H335-H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,C |
| Risk Statements | 20/21/22-36/37/38-34 |
| Safety Statements | 26-36-45-36/37/39 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 2904990090 |
