A4335312
2-Fluoro-4-methylaniline , 99% , 452-80-2
Synonym(s):
2-Fluoro-p-toluidine
CAS NO.:452-80-2
Empirical Formula: C7H8FN
Molecular Weight: 125.14
MDL number: MFCD00040975
EINECS: 610-237-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB118.40 | In Stock |
|
| 100G | RMB388.80 | In Stock |
|
| 500g | RMB1845.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 3 °C |
| Boiling point: | 70-71 °C/7 mmHg (lit.) |
| Density | 1.108 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 175 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| pka | 3?+-.0.10(Predicted) |
| color | Clear orange to orange-brown |
| Water Solubility | Not miscible in water. |
| BRN | 2637578 |
| InChI | InChI=1S/C7H8FN/c1-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3 |
| InChIKey | ZQEXBVHABAJPHJ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C)C=C1F |
| CAS DataBase Reference | 452-80-2(CAS DataBase Reference) |
Description and Uses
2-Fluoro-4-methylaniline was used in the preparation of 6-chloro-5-fluoroindole via Leimgruber-Batcho reaction. It was also used in the preparation of an (S)-amino alcohol, 2-amino-3-(2-fluoro-4-methylphenyl)-propan-1-ol.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XU6650000 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







