A4335812
2-Fluoro-5-methylpyridine , 98% , 2369-19-9
CAS NO.:2369-19-9
Empirical Formula: C6H6FN
Molecular Weight: 111.12
MDL number: MFCD00041225
EINECS: 624-867-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB108.00 | In Stock |
|
| 100G | RMB372.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 158-159 °C (lit.) |
| Density | 1.072 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 119 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -0.14±0.10(Predicted) |
| form | Liquid |
| color | Colorless to pale yellow |
| Specific Gravity | 1.077 |
| BRN | 107085 |
| InChI | InChI=1S/C6H6FN/c1-5-2-3-6(7)8-4-5/h2-4H,1H3 |
| InChIKey | AOSOZARHUJMBLZ-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=C(C)C=C1 |
| CAS DataBase Reference | 2369-19-9(CAS DataBase Reference) |
Description and Uses
2-Fluoro-5-methylpyridine serves as a starting material for the preparation of 6-fluoronicotinic acid[6].
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |






