A4336012
4-Fluoro-3-methylaniline , 98% , 452-69-7
Synonym(s):
5-Amino-2-fluorotoluene
CAS NO.:452-69-7
Empirical Formula: C7H8FN
Molecular Weight: 125.14
MDL number: MFCD00025294
EINECS: 207-207-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB55.20 | In Stock |
|
| 100G | RMB167.20 | In Stock |
|
| 500g | RMB720.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35 °C |
| Boiling point: | 85-86°C 9mm |
| Density | 1,12 g/cm3 |
| refractive index | 1.5370 |
| Flash point: | 95°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.78±0.10(Predicted) |
| color | White to Gray |
| BRN | 2935561 |
| InChI | InChI=1S/C7H8FN/c1-5-4-6(9)2-3-7(5)8/h2-4H,9H2,1H3 |
| InChIKey | NYMDPDNETOLVBS-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C(C)=C1 |
| CAS DataBase Reference | 452-69-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluoro-3-methylaniline(452-69-7) |
Description and Uses
4-Fluoro-3-methylaniline may be used to synthesize 4-methoxy-3′-methyl-4′-fluorobiphenyl and diimine Schiff bases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-36-27 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






