A4338212
2-Fluoro-4-methoxybenzaldehyde , 97% , 331-64-6
Synonym(s):
2-Fluoro-p-anisaldehyde
CAS NO.:331-64-6
Empirical Formula: C8H7FO2
Molecular Weight: 154.14
MDL number: MFCD00236679
EINECS: 642-882-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.80 | In Stock |
|
| 5G | RMB126.40 | In Stock |
|
| 25G | RMB410.40 | In Stock |
|
| 100G | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-48 °C (lit.) |
| Boiling point: | 226.5±20.0 °C(Predicted) |
| Density | 1.192±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Brown |
| Sensitive | Air Sensitive |
| BRN | 3237954 |
| InChI | InChI=1S/C8H7FO2/c1-11-7-3-2-6(5-10)8(9)4-7/h2-5H,1H3 |
| InChIKey | UNWQNFJBBWXFBG-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OC)C=C1F |
| CAS DataBase Reference | 331-64-6(CAS DataBase Reference) |
Description and Uses
2-Fluoro-4-methoxybenzaldehyde may be used in the preparation of:
- fluorine containing 2,4,5-trisubstituted imidazole
- 1-(2-fluoro-4-methoxyphenyl)-2-propanone
- 6-(2-fluoro-4-methoxyphenyl)fulvene
- 10-(2-fluoro-4-methoxyphenyl)-6,7,9,10-tetrahydro-1Hfuro[3,4-b]pyrazolo[3,4-f]quinolin-9-one
- polyhydroquinoline (PHQ)
- 3-(2-fluoro-4-methoxyphenyl) acrylic acid methyl ester
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |





