A4340612
3-Fluoro-4-methoxybenzoic acid , 98% , 403-20-3
CAS NO.:403-20-3
Empirical Formula: C8H7FO3
Molecular Weight: 170.14
MDL number: MFCD00060675
EINECS: 609-820-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB76.80 | In Stock |
|
| 25g | RMB303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-213 °C (lit.) |
| Boiling point: | 286.4±20.0 °C(Predicted) |
| Density | 1.2708 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.13±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2087583 |
| InChI | InChI=1S/C8H7FO3/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4H,1H3,(H,10,11) |
| InChIKey | HYNNNQDQEORWEU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(OC)C(F)=C1 |
| CAS DataBase Reference | 403-20-3(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-methoxybenzoic acid is a fluorinated para-anisic acid derivative. The fluoride substituent enables nucleophilic aromatic substitution, while most of the reactivity centered on the carboxylic group. 3-Fluoro-4-methoxybenzoic acid can undergo various reactions, including Fischer esterification affording esters with ligustrazine moiety for the treatment of Alzheimer's disease.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |







