A4345212
4-(4-Fluorophenyl)-6-isopropyl-2-(N-methyl-N-methanesulfonylamino)-5-pyrimidinecarboxaldehyde , 98% , 147118-37-4
CAS NO.:147118-37-4
Empirical Formula: C16H18FN3O3S
Molecular Weight: 351.4
MDL number: MFCD08458342
EINECS: 604-564-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB283.20 | In Stock |
|
| 100g | RMB714.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178.0 to 182.0 °C |
| Boiling point: | 536.6±60.0 °C(Predicted) |
| Density | 1.320±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) |
| pka | -1.68±0.10(Predicted) |
| form | Solid |
| color | White |
| InChI | InChI=1S/C16H18FN3O3S/c1-10(2)14-13(9-21)15(11-5-7-12(17)8-6-11)19-16(18-14)20(3)24(4,22)23/h5-10H,1-4H3 |
| InChIKey | WOCOTUDOVSLFOB-UHFFFAOYSA-N |
| SMILES | CS(N(C1=NC(C(C)C)=C(C=O)C(C2=CC=C(F)C=C2)=N1)C)(=O)=O |
| CAS DataBase Reference | 147118-37-4(CAS DataBase Reference) |
Description and Uses
Rosuvastatin intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2935.90.9500 |







