A4345812
3-Fluoro-4-methylaniline , 99% , 452-77-7
Synonym(s):
3-Fluoro-p-toluidine;4-Amino-2-fluorotoluene
CAS NO.:452-77-7
Empirical Formula: C7H8FN
Molecular Weight: 125.14
MDL number: MFCD00007762
EINECS: 207-212-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB151.20 | In Stock |
|
| 100G | RMB543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30-32 °C (lit.) |
| Boiling point: | 93°C 12mm |
| Density | 1.093 g/mL at 25 °C (lit.) |
| refractive index | 1.5385-1.5405 |
| Flash point: | 88 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.02±0.10(Predicted) |
| form | powder to lump to clear liquid |
| color | Light yellow to Brown |
| Specific Gravity | 1.093 |
| BRN | 2715987 |
| InChI | InChI=1S/C7H8FN/c1-5-2-3-6(9)4-7(5)8/h2-4H,9H2,1H3 |
| InChIKey | MGRHBBRSAFPBIN-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C)C(F)=C1 |
| CAS DataBase Reference | 452-77-7(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-methylaniline is a synthesized compound that is used to produce anti-cancer agents.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 36/37/38-23/24/25-20/21/22 |
| Safety Statements | 45-36/37/39-26-36/37-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | XU6825000 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1(b) |
| PackingGroup | I |
| HS Code | 29214300 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







