A4348112
2-Fluoro-1,3-dimethylbenzene , 98% , 443-88-9
Synonym(s):
2-Fluoro-m-xylene
CAS NO.:443-88-9
Empirical Formula: C8H9F
Molecular Weight: 124.16
MDL number: MFCD00039215
EINECS: 207-144-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB48.00 | In Stock |
|
| 25G | RMB160.80 | In Stock |
|
| 100G | RMB554.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 147-148 °C(lit.) |
| Density | 0.988 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 87 °F |
| storage temp. | 2-8°C |
| form | liquid |
| color | Clear, colourless |
| Specific Gravity | 0.988 |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1857413 |
| InChI | InChI=1S/C8H9F/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| InChIKey | JTAUTNBVFDTYTI-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=CC(C)=C1F |
| CAS DataBase Reference | 443-88-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Dimethylfluorobenzene(443-88-9) |
Description and Uses
It is used in the spectroscopic observation of jet-cooled 2-fluoro-m-xylyl radical.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P261-P210-P233-P240-P241+P242+P243-P280-P303+P361+P353-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




