A4348212
5-Fluoro-m-xylene , 97% , 461-97-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB423.20 | In Stock |
|
| 500g | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 145 °C |
| Density | 0.98 |
| refractive index | 1.475 |
| Flash point: | 35°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Colourless to light yellow |
| BRN | 1926374 |
| InChI | InChI=1S/C8H9F/c1-6-3-7(2)5-8(9)4-6/h3-5H,1-2H3 |
| InChIKey | RCWIWNUVHNAUQC-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(C)=CC(C)=C1 |
| CAS DataBase Reference | 461-97-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Fluoro-m-xylene(461-97-2) |
Description and Uses
5-Fluoro-m-xylene is used in the synthesis of iminodiaziridines. Also used in the preparation of halogen-containing polyisophthalamides.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Danger |
| Hazard statements | H226 |
| Precautionary statements | P210-P240-P241-P280a-P303+P361+P353-P501a |
| Hazard Codes | F,Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-33-36/37/39-26-23 |
| RIDADR | 1993 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
