A4348512
2-Fluoro-6-hydroxybenzonitrile , 99% , 140675-43-0
CAS NO.：140675-43-0
Empirical Formula: C7H4FNO
Molecular Weight: 137.11
MDL number: MFCD03428592
EINECS: 642-487-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB117.60 | In Stock |
|
| 25g | RMB430.40 | In Stock |
|
| 100g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-158°C |
| Boiling point: | 257.5±25.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 6.17±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 8403914 |
| InChI | InChI=1S/C7H4FNO/c8-6-2-1-3-7(10)5(6)4-9/h1-3,10H |
| InChIKey | YEBHNFDMNFHZFF-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(O)C=CC=C1F |
| CAS DataBase Reference | 140675-43-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H331-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 20/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3276 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
