A4352212
3-Fluoro-4-morpholinoaniline , 98% , 93246-53-8
CAS NO.:93246-53-8
Empirical Formula: C10H13FN2O
Molecular Weight: 196.22
MDL number: MFCD02571270
EINECS: 676-003-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB279.20 | In Stock |
|
| 500g | RMB1188.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-123°C |
| Boiling point: | 364.9±42.0 °C(Predicted) |
| Density | 1.232±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Methanol |
| form | Solid |
| pka | 6.53±0.40(Predicted) |
| color | Off-White to Brown |
| InChI | InChI=1S/C10H13FN2O/c11-9-7-8(12)1-2-10(9)13-3-5-14-6-4-13/h1-2,7H,3-6,12H2 |
| InChIKey | FQGIBHQUVCGEAC-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(N2CCOCC2)C(F)=C1 |
| CAS DataBase Reference | 93246-53-8(CAS DataBase Reference) |
Description and Uses
Intermediate in the synthesis of Linezolid (L466500).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |







