A4352612
[2-[2-(Fmoc-amino)ethoxy]ethoxy]acetic acid , 97% , 166108-71-0
Synonym(s):
8-(Fmoc-amino)-3,6-dioxaoctanoic acid;Fmoc-8-amino-3,6-dioxaoctanoic acid;Fmoc-NH-(PEG)-COOH (9 atoms)
CAS NO.:166108-71-0
Empirical Formula: C21H23NO6
Molecular Weight: 385.41
MDL number: MFCD01321015
EINECS: 200-111-8
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB47.20 | In Stock |
|
| 1G | RMB66.40 | In Stock |
|
| 5g | RMB236.00 | In Stock |
|
| 25g | RMB1017.60 | In Stock |
|
| 100g | RMB3156.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92℃ |
| Boiling point: | 631.4±45.0 °C(Predicted) |
| Density | 1.265±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 3.40±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| InChI | InChI=1S/C21H23NO6/c23-20(24)14-27-12-11-26-10-9-22-21(25)28-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,19H,9-14H2,(H,22,25)(H,23,24) |
| InChIKey | XQPYRJIMPDBGRW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)COCCOCCNC(=O)OCC1C2=C(C=CC=C2)C2=C1C=CC=C2 |
| CAS DataBase Reference | 166108-71-0(CAS DataBase Reference) |
Description and Uses
Fmoc-NH-PEG2-CH2COOH is a PEG linker containing an Fmoc-protected amine and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond.
8-(Fmoc-amino)-3,6-dioxaoctanoic Acid is a hydrophilic, heterobifunctional spacer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29189900 |

![[2-[2-(Fmoc-amino)ethoxy]ethoxy]acetic acid](https://img.chemicalbook.com/CAS/GIF/166108-71-0.gif)

