A4353312
4-Fluorobenzoylacetonitrile , 97% , 4640-67-9
Synonym(s):
3-Oxo-3-(4-fluorophenyl)propionitrile;4-Fluoro-γ-oxobenzenepropanenitrile;4-Fluorophenacyl cyanide
CAS NO.:4640-67-9
Empirical Formula: C9H6FNO
Molecular Weight: 163.15
MDL number: MFCD00662062
EINECS: 627-421-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 25g | RMB230.40 | In Stock |
|
| 100g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-88 °C |
| Boiling point: | 311.9±22.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in dimethylformamide, dimethyl sulfoxide. |
| form | Solid |
| pka | 7.67±0.10(Predicted) |
| color | Yellow |
| λmax | 247nm(EtOH)(lit.) |
| InChI | InChI=1S/C9H6FNO/c10-8-3-1-7(2-4-8)9(12)5-6-11/h1-4H,5H2 |
| InChIKey | LOJBBLDAJBJVBZ-UHFFFAOYSA-N |
| SMILES | C1(=CC=C(F)C=C1)C(=O)CC#N |
| CAS DataBase Reference | 4640-67-9(CAS DataBase Reference) |
Description and Uses
4-Fluorobenzoylacetonitrile is used as a reagent in the synthesis of Blonanserin (B595850); a 5-HT2 serotonin receptor and D2 dopamine receptor antagonist, used as an antipsychotic. 4-Fluorobenzoylacetonitrile is also used in the preparation of pyrazolopyrimidines as potential antimicrobial and antioxidant agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







