A4354212
3-Fluorophthalic anhydride , 98% , 652-39-1
CAS NO.:652-39-1
Empirical Formula: C8H3FO3
Molecular Weight: 166.11
MDL number: MFCD00039696
EINECS: 211-491-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB42.40 | In Stock |
|
| 5G | RMB100.80 | In Stock |
|
| 25G | RMB449.60 | In Stock |
|
| 100g | RMB1758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-163 °C |
| Boiling point: | 283°C(lit.) |
| Density | 1.4338 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Benzene (Slightly), DMSO (Slightly) |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| BRN | 1283580 |
| InChI | InChI=1S/C8H3FO3/c9-5-3-1-2-4-6(5)8(11)12-7(4)10/h1-3H |
| InChIKey | WWJAZKZLSDRAIV-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(F)=CC=C2)C(=O)O1 |
| CAS DataBase Reference | 652-39-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Fluorophthalic anhydride(652-39-1) |
Description and Uses
3-Fluorophthalic anhydride used in the preparation of substituted benzamides with potential neuroleptic activity.1
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 42/43-36/37/38-22 |
| Safety Statements | 45-36/37/39-26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, MOISTURE SENSITIVE |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |






