A4355212
3-Fluorophthalic acid , 98% , 1583-67-1
Synonym(s):
3-Fluoro-1,2-benzenedicarboxylic acid;3-Fluorophthalic acid
CAS NO.：1583-67-1
Empirical Formula: C8H5FO4
Molecular Weight: 184.12
MDL number: MFCD00039524
EINECS: 216-433-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.80 | In Stock |
|
| 5G | RMB148.00 | In Stock |
|
| 25G | RMB617.60 | In Stock |
|
| 100g | RMB2235.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-177 °C (lit.) |
| Boiling point: | 367.9±27.0 °C(Predicted) |
| Density | 1.4111 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | Soluble[in water] |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 2.32±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 2616684 |
| InChI | InChI=1S/C8H5FO4/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | BBCQSMSCEJBIRD-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=CC(F)=C1C(O)=O |
| CAS DataBase Reference | 1583-67-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Fluorophthalic acid(1583-67-1) |
Description and Uses
3-Fluorophthalic acid is a widely used chemical and pharmaceutical intermediate, such as being used in the preparation of third-generation quinolone antibacterial drugs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29173990 |
