A4356812
2-Fluoro-5-iodobenzaldehyde , 97% , 146137-76-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB227.20 | In Stock |
|
| 25G | RMB796.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-48 °C(lit.) |
| Boiling point: | 261.9±25.0 °C(Predicted) |
| Density | 1.962±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Crystals and Chunks |
| color | White to yellow |
| Sensitive | Air & Light Sensitive |
| InChI | InChI=1S/C7H4FIO/c8-7-2-1-6(9)3-5(7)4-10/h1-4H |
| InChIKey | BIRCCQCPGMMGPJ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(I)=CC=C1F |
| CAS DataBase Reference | 146137-76-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P280g-P261-P301+P310-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29130000 |
