A4357712
2-Fluoro-3-(trifluoromethyl)aniline , 97% , 123973-25-1
Synonym(s):
α,α,α,2-Tetrafluoro-m-toluidine;3-Amino-2-fluorobenzotrifluoride
| Pack Size | Price | Stock | Quantity |
| 1G | RMB107.20 | In Stock |
|
| 5G | RMB348.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 189 °C (lit.) |
| Density | 1.39 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 180 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| pka | 1.98±0.10(Predicted) |
| Specific Gravity | 1.390 |
| color | Colourless |
| InChI | InChI=1S/C7H5F4N/c8-6-4(7(9,10)11)2-1-3-5(6)12/h1-3H,12H2 |
| InChIKey | YKPDYPPZLUZONK-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(C(F)(F)F)=C1F |
| CAS DataBase Reference | 123973-25-1(CAS DataBase Reference) |
Description and Uses
2-Fluoro-3-(trifluoromethyl)aniline may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335-H227-H311 |
| Precautionary statements | P280h-P309-P310-P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | PG3 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| HS Code | 29214300 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






